About methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate
methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate (PubChem CID 88873002) has the molecular formula C16H15ClF2N4O3
and a molecular weight of 384.77 g/mol. Its IUPAC name is methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate |
| PubChem CID | 88873002 |
| Molecular Formula | C16H15ClF2N4O3 |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate |
| SMILES | COC(=O)c1cc2nc(Cl)c(NNC(=O)C3CC(F)(F)C3)nc2cc1C |
| InChI | InChI=1S/C16H15ClF2N4O3/c1-7-3-10-11(4-9(7)15(25)26-2)20-12(17)13(21-10)22-23-14(24)8-5-16(18,19)6-8/h3-4,8H,5-6H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | QRHFVIGZQXUAAA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The IUPAC name of methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate (CID 88873002) is methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate.
What is the SMILES notation for methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The canonical SMILES for methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate is COC(=O)c1cc2nc(Cl)c(NNC(=O)C3CC(F)(F)C3)nc2cc1C.
What is the InChIKey of methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
The InChIKey is QRHFVIGZQXUAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClF2N4O3/c1-7-3-10-11(4-9(7)15(25)26-2)20-12(17)13(21-10)22-23-14(24)8-5-16(18,19)6-8/h3-4,8H,5-6H2,1-2H3,(H,21,22)(H,23,24).
What are the key properties of methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate?
methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate has a molecular weight of 384.77 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-2-[2-(3,3-difluorocyclobutanecarbonyl)hydrazinyl]-7-methylquinoxaline-6-carboxylate is sourced from PubChem (CID 88873002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).