C21H20Cl3N5O4S — CID 88873138
(2S)-3-[[amino-(sulfanylamino)methylidene]amino]-2-[[5,7-dichloro-2-(4-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]propanoic acid (PubChem CID 88873138) has the molecular formula C21H20Cl3N5O4S and a molecular weight of 544.85 g/mol. Its IUPAC name is (2S)-3-[[amino-(sulfanylamino)methylidene]amino]-2-[[5,7-dichloro-2-(4-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[[amino-(sulfanylamino)methylidene]amino]-2-[[5,7-dichloro-2-(4-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 88873138 |
| Molecular Formula | C21H20Cl3N5O4S |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | (2S)-3-[[amino-(sulfanylamino)methylidene]amino]-2-[[5,7-dichloro-2-(4-chlorobenzoyl)-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]propanoic acid |
| SMILES | N/C(=N\C[C@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCN(C(=O)c1ccc(Cl)cc1)C2)C(=O)O)NS |
| InChI | InChI=1S/C21H20Cl3N5O4S/c22-12-3-1-10(2-4-12)19(31)29-6-5-13-11(9-29)7-14(23)16(17(13)24)18(30)27-15(20(32)33)8-26-21(25)28-34/h1-4,7,15,34H,5-6,8-9H2,(H,27,30)(H,32,33)(H3,25,26,28)/t15-/m0/s1 |
| InChIKey | WXFDYXFBVVOWAP-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|