C20H25ClN6O3 — CID 88873232
7-chloro-N-[(2S)-1-[[(cyanoamino)-[(3S)-3-hydroxypyrrolidin-1-yl]methylidene]amino]-3-oxopropan-2-yl]-5-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 88873232) has the molecular formula C20H25ClN6O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is 7-chloro-N-[(2S)-1-[[(cyanoamino)-[(3S)-3-hydroxypyrrolidin-1-yl]methylidene]amino]-3-oxopropan-2-yl]-5-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | 7-chloro-N-[(2S)-1-[[(cyanoamino)-[(3S)-3-hydroxypyrrolidin-1-yl]methylidene]amino]-3-oxopropan-2-yl]-5-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 88873232 |
| Molecular Formula | C20H25ClN6O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 7-chloro-N-[(2S)-1-[[(cyanoamino)-[(3S)-3-hydroxypyrrolidin-1-yl]methylidene]amino]-3-oxopropan-2-yl]-5-methyl-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | Cc1c2c(cc(Cl)c1C(=O)N[C@H](C=O)C/N=C(\NC#N)N1CC[C@H](O)C1)CNCC2 |
| InChI | InChI=1S/C20H25ClN6O3/c1-12-16-2-4-23-7-13(16)6-17(21)18(12)19(30)26-14(10-28)8-24-20(25-11-22)27-5-3-15(29)9-27/h6,10,14-15,23,29H,2-5,7-9H2,1H3,(H,24,25)(H,26,30)/t14-,15-/m0/s1 |
| InChIKey | PFFQICFQOGTFSR-GJZGRUSLSA-N |
| XLogP | 0.08 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|