About CID 88874029
CID 88874029 (PubChem CID 88874029) has the molecular formula C13H19BOS
and a molecular weight of 234.17 g/mol.
Molecular Properties
| Compound Name | CID 88874029 |
| PubChem CID | 88874029 |
| Molecular Formula | C13H19BOS |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | — |
| SMILES | [B]/C(C=C(C)C)=C(\C=C(\CO)SC)C(=C)C |
| InChI | InChI=1S/C13H19BOS/c1-9(2)6-13(14)12(10(3)4)7-11(8-15)16-5/h6-7,15H,3,8H2,1-2,4-5H3/b11-7-,13-12+ |
| InChIKey | DGEUXEFIORUWKL-JFJOJTIFSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 88874029 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88874029?
The IUPAC name of CID 88874029 (CID 88874029) is not available.
What is the SMILES notation for CID 88874029?
The canonical SMILES for CID 88874029 is [B]/C(C=C(C)C)=C(\C=C(\CO)SC)C(=C)C.
What is the InChIKey of CID 88874029?
The InChIKey is DGEUXEFIORUWKL-JFJOJTIFSA-N. The full InChI is InChI=1S/C13H19BOS/c1-9(2)6-13(14)12(10(3)4)7-11(8-15)16-5/h6-7,15H,3,8H2,1-2,4-5H3/b11-7-,13-12+.
What are the key properties of CID 88874029?
CID 88874029 has a molecular weight of 234.17 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88874029 is sourced from PubChem (CID 88874029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).