C16H18F6O7 — CID 88874123
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanoate (PubChem CID 88874123) has the molecular formula C16H18F6O7 and a molecular weight of 436.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanoate |
|---|---|
| PubChem CID | 88874123 |
| Molecular Formula | C16H18F6O7 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(4,9-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-4-yl)butanoate |
| SMILES | CC1C(=O)OC2C3OC(C)(CCCC(=O)OC(C(F)(F)F)C(F)(F)F)OC3OC12 |
| InChI | InChI=1S/C16H18F6O7/c1-6-8-9(26-11(6)24)10-12(27-8)29-14(2,28-10)5-3-4-7(23)25-13(15(17,18)19)16(20,21)22/h6,8-10,12-13H,3-5H2,1-2H3 |
| InChIKey | PWSJUVQPOGGOLU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |