About (Z)-6-methoxyoct-6-ene-1,5-diamine
(Z)-6-methoxyoct-6-ene-1,5-diamine (PubChem CID 88874149) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is (Z)-6-methoxyoct-6-ene-1,5-diamine.
Molecular Properties
| Compound Name | (Z)-6-methoxyoct-6-ene-1,5-diamine |
| PubChem CID | 88874149 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (Z)-6-methoxyoct-6-ene-1,5-diamine |
| SMILES | C/C=C(\OC)C(N)CCCCN |
| InChI | InChI=1S/C9H20N2O/c1-3-9(12-2)8(11)6-4-5-7-10/h3,8H,4-7,10-11H2,1-2H3/b9-3- |
| InChIKey | BJFSBQWHOADRCC-OQFOIZHKSA-N |
| XLogP | 0.99 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-methoxyoct-6-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-methoxyoct-6-ene-1,5-diamine?
The IUPAC name of (Z)-6-methoxyoct-6-ene-1,5-diamine (CID 88874149) is (Z)-6-methoxyoct-6-ene-1,5-diamine.
What is the SMILES notation for (Z)-6-methoxyoct-6-ene-1,5-diamine?
The canonical SMILES for (Z)-6-methoxyoct-6-ene-1,5-diamine is C/C=C(\OC)C(N)CCCCN.
What is the InChIKey of (Z)-6-methoxyoct-6-ene-1,5-diamine?
The InChIKey is BJFSBQWHOADRCC-OQFOIZHKSA-N. The full InChI is InChI=1S/C9H20N2O/c1-3-9(12-2)8(11)6-4-5-7-10/h3,8H,4-7,10-11H2,1-2H3/b9-3-.
What are the key properties of (Z)-6-methoxyoct-6-ene-1,5-diamine?
(Z)-6-methoxyoct-6-ene-1,5-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-methoxyoct-6-ene-1,5-diamine is sourced from PubChem (CID 88874149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).