C8H16O8S2 — CID 88874314
(1R,2R,3S,4S)-1-(1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol (PubChem CID 88874314) has the molecular formula C8H16O8S2 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1R,2R,3S,4S)-1-(1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S)-1-(1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 88874314 |
| Molecular Formula | C8H16O8S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | (1R,2R,3S,4S)-1-(1,1,3,3-tetraoxo-1,3-dithiolan-2-yl)pentane-1,2,3,4-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C1S(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C8H16O8S2/c1-4(9)5(10)6(11)7(12)8-17(13,14)2-3-18(8,15)16/h4-12H,2-3H2,1H3/t4-,5-,6+,7+/m0/s1 |
| InChIKey | LKYRZFJFPVXKHH-VWDOSNQTSA-N |
| XLogP | -3.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |