C20H26N2OS — CID 88874513
4-tert-butyl-N-[[(2E)-2-ethenyl-3-methylpenta-2,4-dienyl]carbamothioyl]benzamide (PubChem CID 88874513) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[[(2E)-2-ethenyl-3-methylpenta-2,4-dienyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[(2E)-2-ethenyl-3-methylpenta-2,4-dienyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 88874513 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-tert-butyl-N-[[(2E)-2-ethenyl-3-methylpenta-2,4-dienyl]carbamothioyl]benzamide |
| SMILES | C=C/C(C)=C(\C=C)CNC(=S)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2OS/c1-7-14(3)15(8-2)13-21-19(24)22-18(23)16-9-11-17(12-10-16)20(4,5)6/h7-12H,1-2,13H2,3-6H3,(H2,21,22,23,24)/b15-14+ |
| InChIKey | UAAGQXAOVOWDMJ-CCEZHUSRSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|