About (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid
(2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid (PubChem CID 88874568) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid.
Molecular Properties
| Compound Name | (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid |
| PubChem CID | 88874568 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid |
| SMILES | C=C/C(N)=C(\C=C/C)C(=O)O |
| InChI | InChI=1S/C8H11NO2/c1-3-5-6(8(10)11)7(9)4-2/h3-5H,2,9H2,1H3,(H,10,11)/b5-3-,7-6- |
| InChIKey | DHWHGGSLDAAZJA-VKLRWAGZSA-N |
| XLogP | 1.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid?
The IUPAC name of (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid (CID 88874568) is (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid.
What is the SMILES notation for (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid?
The canonical SMILES for (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid is C=C/C(N)=C(\C=C/C)C(=O)O.
What is the InChIKey of (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid?
The InChIKey is DHWHGGSLDAAZJA-VKLRWAGZSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-5-6(8(10)11)7(9)4-2/h3-5H,2,9H2,1H3,(H,10,11)/b5-3-,7-6-.
What are the key properties of (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid?
(2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid has a molecular weight of 153.18 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-amino-2-[(Z)-prop-1-enyl]penta-2,4-dienoic acid is sourced from PubChem (CID 88874568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).