C10H12N2 — CID 88874862
N-[(1Z,5Z)-3,4-dimethylidene-6-(methylideneamino)hexa-1,5-dienyl]methanimine (PubChem CID 88874862) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N-[(1Z,5Z)-3,4-dimethylidene-6-(methylideneamino)hexa-1,5-dienyl]methanimine.
| Compound Name | N-[(1Z,5Z)-3,4-dimethylidene-6-(methylideneamino)hexa-1,5-dienyl]methanimine |
|---|---|
| PubChem CID | 88874862 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-[(1Z,5Z)-3,4-dimethylidene-6-(methylideneamino)hexa-1,5-dienyl]methanimine |
| SMILES | C=N/C=C\C(=C)C(=C)/C=C\N=C |
| InChI | InChI=1S/C10H12N2/c1-9(5-7-11-3)10(2)6-8-12-4/h5-8H,1-4H2/b7-5-,8-6- |
| InChIKey | ZVRNYRHJVHXWEF-SFECMWDFSA-N |
| XLogP | 2.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|