C13H23NO2 — CID 88874996
ethyl (4Z)-5-[(dimethylamino)methyl]-4-methylhepta-4,6-dienoate (PubChem CID 88874996) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is ethyl (4Z)-5-[(dimethylamino)methyl]-4-methylhepta-4,6-dienoate.
| Compound Name | ethyl (4Z)-5-[(dimethylamino)methyl]-4-methylhepta-4,6-dienoate |
|---|---|
| PubChem CID | 88874996 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethyl (4Z)-5-[(dimethylamino)methyl]-4-methylhepta-4,6-dienoate |
| SMILES | C=C/C(CN(C)C)=C(\C)CCC(=O)OCC |
| InChI | InChI=1S/C13H23NO2/c1-6-12(10-14(4)5)11(3)8-9-13(15)16-7-2/h6H,1,7-10H2,2-5H3/b12-11- |
| InChIKey | SMXNDQPHJYHGAB-QXMHVHEDSA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|