C17H30O — CID 88875679
(2R)-2-methyl-3-pent-4-enyl-2-[2-[(1R,4S)-2,2,4-trimethylcyclobutyl]ethyl]oxirane (PubChem CID 88875679) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (2R)-2-methyl-3-pent-4-enyl-2-[2-[(1R,4S)-2,2,4-trimethylcyclobutyl]ethyl]oxirane.
| Compound Name | (2R)-2-methyl-3-pent-4-enyl-2-[2-[(1R,4S)-2,2,4-trimethylcyclobutyl]ethyl]oxirane |
|---|---|
| PubChem CID | 88875679 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (2R)-2-methyl-3-pent-4-enyl-2-[2-[(1R,4S)-2,2,4-trimethylcyclobutyl]ethyl]oxirane |
| SMILES | C=CCCCC1O[C@]1(C)CC[C@@H]1[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C17H30O/c1-6-7-8-9-15-17(5,18-15)11-10-14-13(2)12-16(14,3)4/h6,13-15H,1,7-12H2,2-5H3/t13-,14+,15?,17+/m0/s1 |
| InChIKey | HRRIBEZZMJTRFS-HJGDVNRJSA-N |
| XLogP | 4.96 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|