C11H16N2 — CID 88875884
(3E,5E)-6-(1,2,3,6-tetrahydropyridin-4-yl)hexa-1,3,5-trien-3-amine (PubChem CID 88875884) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (3E,5E)-6-(1,2,3,6-tetrahydropyridin-4-yl)hexa-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-6-(1,2,3,6-tetrahydropyridin-4-yl)hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 88875884 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3E,5E)-6-(1,2,3,6-tetrahydropyridin-4-yl)hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C=C\C1=CCNCC1 |
| InChI | InChI=1S/C11H16N2/c1-2-11(12)5-3-4-10-6-8-13-9-7-10/h2-6,13H,1,7-9,12H2/b4-3+,11-5+ |
| InChIKey | ANPPRXHHWOBYAX-ZHBGKXFASA-N |
| XLogP | 1.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|