About [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate
[5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 88875925) has the molecular formula C20H18F3NO7S
and a molecular weight of 473.43 g/mol. Its IUPAC name is [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate |
| PubChem CID | 88875925 |
| Molecular Formula | C20H18F3NO7S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(-c2cnc3c(OC)c(OC)ccc3c2)cc(OS(=O)(=O)C(F)(F)F)c1OC |
| InChI | InChI=1S/C20H18F3NO7S/c1-27-14-6-5-11-7-13(10-24-17(11)19(14)30-4)12-8-15(28-2)18(29-3)16(9-12)31-32(25,26)20(21,22)23/h5-10H,1-4H3 |
| InChIKey | QKDUXWQHXCDYKG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate?
The IUPAC name of [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate (CID 88875925) is [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate.
What is the SMILES notation for [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate?
The canonical SMILES for [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate is COc1cc(-c2cnc3c(OC)c(OC)ccc3c2)cc(OS(=O)(=O)C(F)(F)F)c1OC.
What is the InChIKey of [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate?
The InChIKey is QKDUXWQHXCDYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F3NO7S/c1-27-14-6-5-11-7-13(10-24-17(11)19(14)30-4)12-8-15(28-2)18(29-3)16(9-12)31-32(25,26)20(21,22)23/h5-10H,1-4H3.
What are the key properties of [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate?
[5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate has a molecular weight of 473.43 g/mol, XLogP of 4.16, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(7,8-dimethoxyquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate is sourced from PubChem (CID 88875925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).