About 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile
2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile (PubChem CID 88875944) has the molecular formula C10H3BrN2S2
and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile |
| PubChem CID | 88875944 |
| Molecular Formula | C10H3BrN2S2 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc2sc(Br)cc2s1 |
| InChI | InChI=1S/C10H3BrN2S2/c11-10-3-9-8(15-10)2-7(14-9)1-6(4-12)5-13/h1-3H |
| InChIKey | VFPFBOKLFAHPIE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile?
The IUPAC name of 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile (CID 88875944) is 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile.
What is the SMILES notation for 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile?
The canonical SMILES for 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile is N#CC(C#N)=Cc1cc2sc(Br)cc2s1.
What is the InChIKey of 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile?
The InChIKey is VFPFBOKLFAHPIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3BrN2S2/c11-10-3-9-8(15-10)2-7(14-9)1-6(4-12)5-13/h1-3H.
What are the key properties of 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile?
2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile has a molecular weight of 295.19 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromothieno[3,2-b]thiophen-2-yl)methylidene]propanedinitrile is sourced from PubChem (CID 88875944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).