About 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine
1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 88876008) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine.
Molecular Properties
| Compound Name | 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine |
| PubChem CID | 88876008 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CN(C)c1ccc2c(c1)CCCN2Cl |
| InChI | InChI=1S/C11H15ClN2/c1-13(2)10-5-6-11-9(8-10)4-3-7-14(11)12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | KYYRZJNLORDBFC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine?
The IUPAC name of 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine (CID 88876008) is 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine.
What is the SMILES notation for 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine?
The canonical SMILES for 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine is CN(C)c1ccc2c(c1)CCCN2Cl.
What is the InChIKey of 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine?
The InChIKey is KYYRZJNLORDBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2/c1-13(2)10-5-6-11-9(8-10)4-3-7-14(11)12/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine?
1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine has a molecular weight of 210.71 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-dimethyl-3,4-dihydro-2H-quinolin-6-amine is sourced from PubChem (CID 88876008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).