C24H28FN5O3S2 — CID 88876035
1-[2-[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methylamino]ethylsulfanyl]ethenyl (1Z)-N-aminomethanimidothioate (PubChem CID 88876035) has the molecular formula C24H28FN5O3S2 and a molecular weight of 517.65 g/mol. Its IUPAC name is 1-[2-[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methylamino]ethylsulfanyl]ethenyl (1Z)-N-aminomethanimidothioate.
| Compound Name | 1-[2-[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methylamino]ethylsulfanyl]ethenyl (1Z)-N-aminomethanimidothioate |
|---|---|
| PubChem CID | 88876035 |
| Molecular Formula | C24H28FN5O3S2 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 1-[2-[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methylamino]ethylsulfanyl]ethenyl (1Z)-N-aminomethanimidothioate |
| SMILES | C=C(S/C=N\N)SCCNCc1ccc(-c2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)cc1 |
| InChI | InChI=1S/C24H28FN5O3S2/c1-16(31)28-13-21-14-30(24(32)33-21)20-7-8-22(23(25)11-20)19-5-3-18(4-6-19)12-27-9-10-34-17(2)35-15-29-26/h3-8,11,15,21,27H,2,9-10,12-14,26H2,1H3,(H,28,31)/b29-15-/t21-/m0/s1 |
| InChIKey | LOWOOBBUEIYRDL-ICIGSMAMSA-N |
| XLogP | 3.88 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|