C8H14N2 — CID 88876125
(1Z,3E)-3,5-dimethylhexa-1,3,5-triene-1,4-diamine (PubChem CID 88876125) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1Z,3E)-3,5-dimethylhexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1Z,3E)-3,5-dimethylhexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 88876125 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1Z,3E)-3,5-dimethylhexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C(C)/C(N)=C(C)\C=C/N |
| InChI | InChI=1S/C8H14N2/c1-6(2)8(10)7(3)4-5-9/h4-5H,1,9-10H2,2-3H3/b5-4-,8-7+ |
| InChIKey | RDVCZIGPTOTWIC-KXKKYDSASA-N |
| XLogP | 1.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|