C25H31F3N4O4S2 — CID 88876763
(5R)-5-methyl-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperazin-2-one (PubChem CID 88876763) has the molecular formula C25H31F3N4O4S2 and a molecular weight of 572.68 g/mol. Its IUPAC name is (5R)-5-methyl-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperazin-2-one.
| Compound Name | (5R)-5-methyl-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 88876763 |
| Molecular Formula | C25H31F3N4O4S2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | (5R)-5-methyl-4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperazin-2-one |
| SMILES | C[C@@H]1CNC(=O)CN1C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ccc([C@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H31F3N4O4S2/c1-17-13-29-23(33)16-30(17)14-20-15-31(38(35,36)22-6-4-3-5-21(22)37)11-12-32(20)19-9-7-18(8-10-19)24(2,34)25(26,27)28/h3-4,6-10,17,20,34H,5,11-16H2,1-2H3,(H,29,33)/t17-,20+,24+/m1/s1 |
| InChIKey | YHVGLDWHQHGKMD-YQOVMPOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|