C22H42O5S2Si — CID 88876874
S-[2-[2-(2-acetylsulfanylethyl)-4-(2-triethoxysilylethyl)cyclohexyl]ethyl] ethanethioate (PubChem CID 88876874) has the molecular formula C22H42O5S2Si and a molecular weight of 478.79 g/mol. Its IUPAC name is S-[2-[2-(2-acetylsulfanylethyl)-4-(2-triethoxysilylethyl)cyclohexyl]ethyl] ethanethioate.
| Compound Name | S-[2-[2-(2-acetylsulfanylethyl)-4-(2-triethoxysilylethyl)cyclohexyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 88876874 |
| Molecular Formula | C22H42O5S2Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | S-[2-[2-(2-acetylsulfanylethyl)-4-(2-triethoxysilylethyl)cyclohexyl]ethyl] ethanethioate |
| SMILES | CCO[Si](CCC1CCC(CCSC(C)=O)C(CCSC(C)=O)C1)(OCC)OCC |
| InChI | InChI=1S/C22H42O5S2Si/c1-6-25-30(26-7-2,27-8-3)16-13-20-9-10-21(11-14-28-18(4)23)22(17-20)12-15-29-19(5)24/h20-22H,6-17H2,1-5H3 |
| InChIKey | JXSJIEFZRXGBTE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|