C16H20ClNO — CID 88876908
(1S,9R,10R)-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene;hydrochloride (PubChem CID 88876908) has the molecular formula C16H20ClNO and a molecular weight of 277.79 g/mol. Its IUPAC name is (1S,9R,10R)-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene;hydrochloride.
| Compound Name | (1S,9R,10R)-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene;hydrochloride |
|---|---|
| PubChem CID | 88876908 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.79 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (1S,9R,10R)-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene;hydrochloride |
| SMILES | Cl.[O-][NH+]1CC[C@]23C=CCC[C@H]2[C@H]1Cc1ccccc13 |
| InChI | InChI=1S/C16H19NO.ClH/c18-17-10-9-16-8-4-3-7-14(16)15(17)11-12-5-1-2-6-13(12)16;/h1-2,4-6,8,14-15,17H,3,7,9-11H2;1H/t14-,15+,16-;/m0./s1 |
| InChIKey | QINWKIPLBDHCHZ-CLUYDPBTSA-N |
| XLogP | 2.02 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|