C28H42O3 — CID 88877148
(2'R,9'R,12'E)-1',2',5'-trimethyl-14',14'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,6'-tricyclo[11.4.0.05,9]heptadec-12-ene]-15'-one (PubChem CID 88877148) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2'R,9'R,12'E)-1',2',5'-trimethyl-14',14'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,6'-tricyclo[11.4.0.05,9]heptadec-12-ene]-15'-one.
| Compound Name | (2'R,9'R,12'E)-1',2',5'-trimethyl-14',14'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,6'-tricyclo[11.4.0.05,9]heptadec-12-ene]-15'-one |
|---|---|
| PubChem CID | 88877148 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2'R,9'R,12'E)-1',2',5'-trimethyl-14',14'-bis(prop-2-enyl)spiro[1,3-dioxolane-2,6'-tricyclo[11.4.0.05,9]heptadec-12-ene]-15'-one |
| SMILES | C=CCC1(CC=C)C(=O)CCC2(C)/C1=C\CC[C@@H]1CCC3(OCCO3)C1(C)CC[C@H]2C |
| InChI | InChI=1S/C28H42O3/c1-6-14-27(15-7-2)23-10-8-9-22-12-18-28(30-19-20-31-28)26(22,5)17-11-21(3)25(23,4)16-13-24(27)29/h6-7,10,21-22H,1-2,8-9,11-20H2,3-5H3/b23-10+/t21-,22-,25?,26?/m1/s1 |
| InChIKey | ABHMIHPYOMNNMP-OYRLFHHQSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|