C20H23N3O2S — CID 88877234
1-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-3-methylthiophen-2-yl]-2-hydroxypropan-1-one (PubChem CID 88877234) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-3-methylthiophen-2-yl]-2-hydroxypropan-1-one.
| Compound Name | 1-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-3-methylthiophen-2-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 88877234 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)-3-methylthiophen-2-yl]-2-hydroxypropan-1-one |
| SMILES | Cc1cc(/N=N/c2cc3c4c(c2)CCCN4CCC3)sc1C(=O)C(C)O |
| InChI | InChI=1S/C20H23N3O2S/c1-12-9-17(26-20(12)19(25)13(2)24)22-21-16-10-14-5-3-7-23-8-4-6-15(11-16)18(14)23/h9-11,13,24H,3-8H2,1-2H3/b22-21+ |
| InChIKey | NTWDDOPOSPUPFD-QURGRASLSA-N |
| XLogP | 4.73 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|