C23H32O4P2 — CID 88877397
(9S,10S,14S,15S,17S,18S,22S,23S)-9,12,12,20,20,23-hexamethyl-11,13,19,21-tetraoxa-1,8-diphosphahexacyclo[15.6.0.02,7.08,15.010,14.018,22]tricosa-2,4,6-triene (PubChem CID 88877397) has the molecular formula C23H32O4P2 and a molecular weight of 434.45 g/mol. Its IUPAC name is (9S,10S,14S,15S,17S,18S,22S,23S)-9,12,12,20,20,23-hexamethyl-11,13,19,21-tetraoxa-1,8-diphosphahexacyclo[15.6.0.02,7.08,15.010,14.018,22]tricosa-2,4,6-triene.
| Compound Name | (9S,10S,14S,15S,17S,18S,22S,23S)-9,12,12,20,20,23-hexamethyl-11,13,19,21-tetraoxa-1,8-diphosphahexacyclo[15.6.0.02,7.08,15.010,14.018,22]tricosa-2,4,6-triene |
|---|---|
| PubChem CID | 88877397 |
| Molecular Formula | C23H32O4P2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (9S,10S,14S,15S,17S,18S,22S,23S)-9,12,12,20,20,23-hexamethyl-11,13,19,21-tetraoxa-1,8-diphosphahexacyclo[15.6.0.02,7.08,15.010,14.018,22]tricosa-2,4,6-triene |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@@H]2[C@@H]2C[C@H]3[C@H]4OC(C)(C)O[C@@H]4[C@H](C)P3c3ccccc3P12 |
| InChI | InChI=1S/C23H32O4P2/c1-12-18-20(26-22(3,4)24-18)16-11-17-21-19(25-23(5,6)27-21)13(2)29(17)15-10-8-7-9-14(15)28(12)16/h7-10,12-13,16-21H,11H2,1-6H3/t12-,13-,16-,17-,18+,19+,20+,21+,28?,29?/m0/s1 |
| InChIKey | ROJCMMFUFGJKBO-WTIGTKKCSA-N |
| XLogP | 3.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|