C15H19Br3O3 — CID 88877404
(2R,5R,7S)-5,7-dibromo-2-(3-bromopropa-1,2-dienyl)-8-ethyl-3,3a,5,6,7,8,8a,8b-octahydro-2H-furo[3,2-b][1]benzofuran-4a-ol (PubChem CID 88877404) has the molecular formula C15H19Br3O3 and a molecular weight of 487.03 g/mol. Its IUPAC name is (2R,5R,7S)-5,7-dibromo-2-(3-bromopropa-1,2-dienyl)-8-ethyl-3,3a,5,6,7,8,8a,8b-octahydro-2H-furo[3,2-b][1]benzofuran-4a-ol.
| Compound Name | (2R,5R,7S)-5,7-dibromo-2-(3-bromopropa-1,2-dienyl)-8-ethyl-3,3a,5,6,7,8,8a,8b-octahydro-2H-furo[3,2-b][1]benzofuran-4a-ol |
|---|---|
| PubChem CID | 88877404 |
| Molecular Formula | C15H19Br3O3 |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 483.89 |
| IUPAC Name | (2R,5R,7S)-5,7-dibromo-2-(3-bromopropa-1,2-dienyl)-8-ethyl-3,3a,5,6,7,8,8a,8b-octahydro-2H-furo[3,2-b][1]benzofuran-4a-ol |
| SMILES | CCC1C2C3O[C@@H](C=C=CBr)CC3OC2(O)[C@H](Br)C[C@@H]1Br |
| InChI | InChI=1S/C15H19Br3O3/c1-2-9-10(17)7-12(18)15(19)13(9)14-11(21-15)6-8(20-14)4-3-5-16/h4-5,8-14,19H,2,6-7H2,1H3/t3?,8-,9?,10-,11?,12+,13?,14?,15?/m0/s1 |
| InChIKey | OUMZHLOKCPXJMJ-LIIDSNQHSA-N |
| XLogP | 3.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|