C26H4F14 — CID 88877500
1,2,3,4,6-pentafluoro-10-(2,3,4,5,6-pentafluorophenyl)-9-(2,3,5,6-tetrafluorophenyl)anthracene (PubChem CID 88877500) has the molecular formula C26H4F14 and a molecular weight of 582.29 g/mol. Its IUPAC name is 1,2,3,4,6-pentafluoro-10-(2,3,4,5,6-pentafluorophenyl)-9-(2,3,5,6-tetrafluorophenyl)anthracene.
| Compound Name | 1,2,3,4,6-pentafluoro-10-(2,3,4,5,6-pentafluorophenyl)-9-(2,3,5,6-tetrafluorophenyl)anthracene |
|---|---|
| PubChem CID | 88877500 |
| Molecular Formula | C26H4F14 |
| Molecular Weight | 582.29 g/mol |
| Exact Mass | 582.01 |
| IUPAC Name | 1,2,3,4,6-pentafluoro-10-(2,3,4,5,6-pentafluorophenyl)-9-(2,3,5,6-tetrafluorophenyl)anthracene |
| SMILES | Fc1ccc2c(-c3c(F)c(F)cc(F)c3F)c3c(F)c(F)c(F)c(F)c3c(-c3c(F)c(F)c(F)c(F)c3F)c2c1 |
| InChI | InChI=1S/C26H4F14/c27-5-1-2-6-7(3-5)11(15-20(34)24(38)26(40)25(39)21(15)35)13-12(18(32)22(36)23(37)19(13)33)10(6)14-16(30)8(28)4-9(29)17(14)31/h1-4H |
| InChIKey | VINFLTXQXKSCAN-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.29 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|