C11H16F3N — CID 88877671
(Z)-1,1,1-trifluoro-N,6,6-trimethyl-5-methylidenehept-3-en-2-imine (PubChem CID 88877671) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-N,6,6-trimethyl-5-methylidenehept-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-N,6,6-trimethyl-5-methylidenehept-3-en-2-imine |
|---|---|
| PubChem CID | 88877671 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (Z)-1,1,1-trifluoro-N,6,6-trimethyl-5-methylidenehept-3-en-2-imine |
| SMILES | C=C(/C=C\C(=N\C)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H16F3N/c1-8(10(2,3)4)6-7-9(15-5)11(12,13)14/h6-7H,1H2,2-5H3/b7-6-,15-9- |
| InChIKey | GGVJGAUHIIJLQY-QFVQWYESSA-N |
| XLogP | 3.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|