C14H20FN — CID 88877714
2-[(2E,4Z)-6-fluoro-5-methylhepta-2,4,6-trien-3-yl]-7-azabicyclo[2.2.1]heptane (PubChem CID 88877714) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-fluoro-5-methylhepta-2,4,6-trien-3-yl]-7-azabicyclo[2.2.1]heptane.
| Compound Name | 2-[(2E,4Z)-6-fluoro-5-methylhepta-2,4,6-trien-3-yl]-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 88877714 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-[(2E,4Z)-6-fluoro-5-methylhepta-2,4,6-trien-3-yl]-7-azabicyclo[2.2.1]heptane |
| SMILES | C=C(F)/C(C)=C\C(=C/C)C1CC2CCC1N2 |
| InChI | InChI=1S/C14H20FN/c1-4-11(7-9(2)10(3)15)13-8-12-5-6-14(13)16-12/h4,7,12-14,16H,3,5-6,8H2,1-2H3/b9-7-,11-4+ |
| InChIKey | JSDZSFHJNFJTLW-WHIYXEERSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|