C25H30N4O4S — CID 88877771
2-[2-[[5-[[(4S,5R,6S)-2-formyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 88877771) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[2-[[5-[[(4S,5R,6S)-2-formyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[[5-[[(4S,5R,6S)-2-formyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 88877771 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-[2-[[5-[[(4S,5R,6S)-2-formyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C=O)=C(COc3cccc4c(CSCCN=C(N)N)cccc34)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C25H30N4O4S/c1-14-19(20(11-30)29-23(14)22(15(2)31)24(29)32)12-33-21-8-4-6-17-16(5-3-7-18(17)21)13-34-10-9-28-25(26)27/h3-8,11,14-15,22-23,31H,9-10,12-13H2,1-2H3,(H4,26,27,28)/t14-,15+,22+,23+/m0/s1 |
| InChIKey | ZVGHCSMZTNHGJD-XJYMPBJPSA-N |
| XLogP | 2.04 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|