About 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene
4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene (PubChem CID 88878107) has the molecular formula C14H26S
and a molecular weight of 226.43 g/mol. Its IUPAC name is 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene.
Molecular Properties
| Compound Name | 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene |
| PubChem CID | 88878107 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene |
| SMILES | C=CCC(CC)(CC=C)CSC(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-7-10-14(9-3,11-8-2)12-15-13(4,5)6/h7-8H,1-2,9-12H2,3-6H3 |
| InChIKey | QSQSSFPJJROBAY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene?
The IUPAC name of 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene (CID 88878107) is 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene.
What is the SMILES notation for 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene?
The canonical SMILES for 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene is C=CCC(CC)(CC=C)CSC(C)(C)C.
What is the InChIKey of 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene?
The InChIKey is QSQSSFPJJROBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S/c1-7-10-14(9-3,11-8-2)12-15-13(4,5)6/h7-8H,1-2,9-12H2,3-6H3.
What are the key properties of 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene?
4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene has a molecular weight of 226.43 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tert-butylsulfanylmethyl)-4-ethylhepta-1,6-diene is sourced from PubChem (CID 88878107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).