C20H22N4O3S — CID 88878180
1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 88878180) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88878180 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | Cc1cnc(Nc2nc(C(O)CO)cs2)c(OC2CCCc3ncccc32)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-12-8-18(27-17-6-2-5-14-13(17)4-3-7-21-14)19(22-9-12)24-20-23-15(11-28-20)16(26)10-25/h3-4,7-9,11,16-17,25-26H,2,5-6,10H2,1H3,(H,22,23,24) |
| InChIKey | LKTSIKYSIHAWCL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |