C19H21N5O3S — CID 88878191
1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol (PubChem CID 88878191) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88878191 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[2-[[5-methyl-3-(5,6,7,8-tetrahydroquinazolin-5-yloxy)-2-pyridinyl]amino]-1,3-thiazol-4-yl]ethane-1,2-diol |
| SMILES | Cc1cnc(Nc2nc(C(O)CO)cs2)c(OC2CCCc3ncncc32)c1 |
| InChI | InChI=1S/C19H21N5O3S/c1-11-5-17(27-16-4-2-3-13-12(16)7-20-10-22-13)18(21-6-11)24-19-23-14(9-28-19)15(26)8-25/h5-7,9-10,15-16,25-26H,2-4,8H2,1H3,(H,21,23,24) |
| InChIKey | FXCBLQXZUXJDGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |