C77H60N6 — CID 88878701
2,7-bis[4-(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-dimethylphenyl]carbazole (PubChem CID 88878701) has the molecular formula C77H60N6 and a molecular weight of 1069.37 g/mol. Its IUPAC name is 2,7-bis[4-(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-dimethylphenyl]carbazole.
| Compound Name | 2,7-bis[4-(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-dimethylphenyl]carbazole |
|---|---|
| PubChem CID | 88878701 |
| Molecular Formula | C77H60N6 |
| Molecular Weight | 1069.37 g/mol |
| Exact Mass | 1068.49 |
| IUPAC Name | 2,7-bis[4-(3,6-dimethylcarbazol-9-yl)-2-methylphenyl]-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-dimethylphenyl]carbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2ccc3c4ccc(-c5ccc(-n6c7ccc(C)cc7c7cc(C)ccc76)cc5C)cc4n(-c4c(C)cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4C)c3c2)c(C)c1 |
| InChI | InChI=1S/C77H60N6/c1-45-19-31-68-64(35-45)65-36-46(2)20-32-69(65)81(68)58-25-29-60(49(5)41-58)55-23-27-62-63-28-24-56(61-30-26-59(42-50(61)6)82-70-33-21-47(3)37-66(70)67-38-48(4)22-34-71(67)82)44-73(63)83(72(62)43-55)74-51(7)39-57(40-52(74)8)77-79-75(53-15-11-9-12-16-53)78-76(80-77)54-17-13-10-14-18-54/h9-44H,1-8H3 |
| InChIKey | DZRUMSAMCJNTBX-UHFFFAOYSA-N |
| XLogP | 19.97 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.37 |
| LogP ≤ 5 | 19.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |