C66H43N7 — CID 88878761
2,7-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(4-phenylphenyl)carbazole (PubChem CID 88878761) has the molecular formula C66H43N7 and a molecular weight of 934.12 g/mol. Its IUPAC name is 2,7-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(4-phenylphenyl)carbazole.
| Compound Name | 2,7-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(4-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 88878761 |
| Molecular Formula | C66H43N7 |
| Molecular Weight | 934.12 g/mol |
| Exact Mass | 933.36 |
| IUPAC Name | 2,7-bis[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-(4-phenylphenyl)carbazole |
| SMILES | c1ccc(-c2ccc(-n3c4cc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)ccc4c4ccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)cc43)cc2)cc1 |
| InChI | InChI=1S/C66H43N7/c1-6-18-44(19-7-1)45-32-36-56(37-33-45)73-59-42-52(50-28-16-30-54(40-50)65-69-61(46-20-8-2-9-21-46)67-62(70-65)47-22-10-3-11-23-47)34-38-57(59)58-39-35-53(43-60(58)73)51-29-17-31-55(41-51)66-71-63(48-24-12-4-13-25-48)68-64(72-66)49-26-14-5-15-27-49/h1-43H |
| InChIKey | LWIJLELAWCTFRP-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.12 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |