About 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine
2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine (PubChem CID 88878782) has the molecular formula C13H16BrNO
and a molecular weight of 282.18 g/mol. Its IUPAC name is 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine.
Molecular Properties
| Compound Name | 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine |
| PubChem CID | 88878782 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine |
| SMILES | Brc1cccc(OC2C[C@H]3CC[C@@H](C2)C3)n1 |
| InChI | InChI=1S/C13H16BrNO/c14-12-2-1-3-13(15-12)16-11-7-9-4-5-10(6-9)8-11/h1-3,9-11H,4-8H2/t9-,10+,11? |
| InChIKey | SCRPLOWHJWLUCF-ZACCUICWSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine?
The IUPAC name of 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine (CID 88878782) is 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine.
What is the SMILES notation for 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine?
The canonical SMILES for 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine is Brc1cccc(OC2C[C@H]3CC[C@@H](C2)C3)n1.
What is the InChIKey of 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine?
The InChIKey is SCRPLOWHJWLUCF-ZACCUICWSA-N. The full InChI is InChI=1S/C13H16BrNO/c14-12-2-1-3-13(15-12)16-11-7-9-4-5-10(6-9)8-11/h1-3,9-11H,4-8H2/t9-,10+,11?.
What are the key properties of 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine?
2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine has a molecular weight of 282.18 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,5R)-3-bicyclo[3.2.1]octanyl]oxy]-6-bromopyridine is sourced from PubChem (CID 88878782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).