C63H30F10N6 — CID 88878792
9-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,7-bis(2-phenylcarbazol-9-yl)carbazole (PubChem CID 88878792) has the molecular formula C63H30F10N6 and a molecular weight of 1060.95 g/mol. Its IUPAC name is 9-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,7-bis(2-phenylcarbazol-9-yl)carbazole.
| Compound Name | 9-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,7-bis(2-phenylcarbazol-9-yl)carbazole |
|---|---|
| PubChem CID | 88878792 |
| Molecular Formula | C63H30F10N6 |
| Molecular Weight | 1060.95 g/mol |
| Exact Mass | 1060.24 |
| IUPAC Name | 9-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,7-bis(2-phenylcarbazol-9-yl)carbazole |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3c(F)c(F)c(F)c(F)c3F)nc(-n3c4cc(-n5c6ccccc6c6ccc(-c7ccccc7)cc65)ccc4c4ccc(-n5c6ccccc6c6ccc(-c7ccccc7)cc65)cc43)n2)c(F)c1F |
| InChI | InChI=1S/C63H30F10N6/c64-51-49(52(65)56(69)59(72)55(51)68)61-74-62(50-53(66)57(70)60(73)58(71)54(50)67)76-63(75-61)79-47-29-35(77-43-17-9-7-15-37(43)39-23-19-33(27-45(39)77)31-11-3-1-4-12-31)21-25-41(47)42-26-22-36(30-48(42)79)78-44-18-10-8-16-38(44)40-24-20-34(28-46(40)78)32-13-5-2-6-14-32/h1-30H |
| InChIKey | QXFLHCIWWMNYCM-UHFFFAOYSA-N |
| XLogP | 17.22 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.95 |
| LogP ≤ 5 | 17.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|