C12H22O2 — CID 88879017
(3E,5E)-4,5-dimethoxy-2,2-dimethylocta-3,5-diene (PubChem CID 88879017) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (3E,5E)-4,5-dimethoxy-2,2-dimethylocta-3,5-diene.
| Compound Name | (3E,5E)-4,5-dimethoxy-2,2-dimethylocta-3,5-diene |
|---|---|
| PubChem CID | 88879017 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (3E,5E)-4,5-dimethoxy-2,2-dimethylocta-3,5-diene |
| SMILES | CC/C=C(OC)\C(=C/C(C)(C)C)OC |
| InChI | InChI=1S/C12H22O2/c1-7-8-10(13-5)11(14-6)9-12(2,3)4/h8-9H,7H2,1-6H3/b10-8+,11-9+ |
| InChIKey | ZPYSSEPDGJHWQM-GFULKKFKSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|