C16H22F4 — CID 88879117
1-tert-butyl-2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)benzene (PubChem CID 88879117) has the molecular formula C16H22F4 and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)benzene.
| Compound Name | 1-tert-butyl-2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)benzene |
|---|---|
| PubChem CID | 88879117 |
| Molecular Formula | C16H22F4 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-tert-butyl-2,3,5,6-tetrafluoro-4-(3-methylpentan-3-yl)benzene |
| SMILES | CCC(C)(CC)c1c(F)c(F)c(C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H22F4/c1-7-16(6,8-2)10-13(19)11(17)9(15(3,4)5)12(18)14(10)20/h7-8H2,1-6H3 |
| InChIKey | CWFXPAMYOOJDMO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|