About (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid
(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid (PubChem CID 88879393) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid.
Molecular Properties
| Compound Name | (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid |
| PubChem CID | 88879393 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid |
| SMILES | Cc1nc(NC(=O)O)sc1C(C)(C)C |
| InChI | InChI=1S/C9H14N2O2S/c1-5-6(9(2,3)4)14-7(10-5)11-8(12)13/h1-4H3,(H,10,11)(H,12,13) |
| InChIKey | GCNSBLBGBDKSSJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The IUPAC name of (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid (CID 88879393) is (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid.
What is the SMILES notation for (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The canonical SMILES for (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid is Cc1nc(NC(=O)O)sc1C(C)(C)C.
What is the InChIKey of (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid?
The InChIKey is GCNSBLBGBDKSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-5-6(9(2,3)4)14-7(10-5)11-8(12)13/h1-4H3,(H,10,11)(H,12,13).
What are the key properties of (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid?
(5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid has a molecular weight of 214.29 g/mol, XLogP of 2.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-4-methyl-1,3-thiazol-2-yl)carbamic acid is sourced from PubChem (CID 88879393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).