C7H5F8NO2 — CID 88879564
1,1,2,2,3,3,4,4-octafluoro-6-isocyanatohexan-1-ol (PubChem CID 88879564) has the molecular formula C7H5F8NO2 and a molecular weight of 287.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-6-isocyanatohexan-1-ol.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-6-isocyanatohexan-1-ol |
|---|---|
| PubChem CID | 88879564 |
| Molecular Formula | C7H5F8NO2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-6-isocyanatohexan-1-ol |
| SMILES | O=C=NCCC(F)(F)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C7H5F8NO2/c8-4(9,1-2-16-3-17)5(10,11)6(12,13)7(14,15)18/h18H,1-2H2 |
| InChIKey | UOOWMOCWHSQMMV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|