About [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate (PubChem CID 888798) has the molecular formula C13H12N2O3S
and a molecular weight of 276.32 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate |
| PubChem CID | 888798 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C13H12N2O3S/c1-9-3-2-4-10(7-9)12(17)18-8-11(16)15-13-14-5-6-19-13/h2-7H,8H2,1H3,(H,14,15,16) |
| InChIKey | SSBKJTXVPIMSIP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate?
The IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate (CID 888798) is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate.
What is the SMILES notation for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate?
The canonical SMILES for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate is Cc1cccc(C(=O)OCC(=O)Nc2nccs2)c1.
What is the InChIKey of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate?
The InChIKey is SSBKJTXVPIMSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-9-3-2-4-10(7-9)12(17)18-8-11(16)15-13-14-5-6-19-13/h2-7H,8H2,1H3,(H,14,15,16).
What are the key properties of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate?
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate has a molecular weight of 276.32 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3-methylbenzoate is sourced from PubChem (CID 888798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).