C18H18F3N3O3 — CID 88880112
2-(6-amino-2-pyridinyl)-4-[3-(trifluoromethoxy)phenoxy]piperidine-1-carbaldehyde (PubChem CID 88880112) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-(6-amino-2-pyridinyl)-4-[3-(trifluoromethoxy)phenoxy]piperidine-1-carbaldehyde.
| Compound Name | 2-(6-amino-2-pyridinyl)-4-[3-(trifluoromethoxy)phenoxy]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 88880112 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(6-amino-2-pyridinyl)-4-[3-(trifluoromethoxy)phenoxy]piperidine-1-carbaldehyde |
| SMILES | Nc1cccc(C2CC(Oc3cccc(OC(F)(F)F)c3)CCN2C=O)n1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)27-14-4-1-3-12(9-14)26-13-7-8-24(11-25)16(10-13)15-5-2-6-17(22)23-15/h1-6,9,11,13,16H,7-8,10H2,(H2,22,23) |
| InChIKey | GOTMYQQADYZSES-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|