About (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate
(7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate (PubChem CID 88880224) has the molecular formula C21H14ClNO7
and a molecular weight of 427.80 g/mol. Its IUPAC name is (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate.
Molecular Properties
| Compound Name | (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate |
| PubChem CID | 88880224 |
| Molecular Formula | C21H14ClNO7 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate |
| SMILES | CC1=Cc2cc3c(cc2C(c2ccc4ccccc4c2)O1)oc(=O)n3O[Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H14ClNO7/c1-12-8-16-10-18-19(29-21(24)23(18)30-22(25,26)27)11-17(16)20(28-12)15-7-6-13-4-2-3-5-14(13)9-15/h2-11,20H,1H3 |
| InChIKey | QCJGOMZAOGXSTA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 122.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate?
The IUPAC name of (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate (CID 88880224) is (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate.
What is the SMILES notation for (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate?
The canonical SMILES for (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate is CC1=Cc2cc3c(cc2C(c2ccc4ccccc4c2)O1)oc(=O)n3O[Cl+3]([O-])([O-])[O-].
What is the InChIKey of (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate?
The InChIKey is QCJGOMZAOGXSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14ClNO7/c1-12-8-16-10-18-19(29-21(24)23(18)30-22(25,26)27)11-17(16)20(28-12)15-7-6-13-4-2-3-5-14(13)9-15/h2-11,20H,1H3.
What are the key properties of (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate?
(7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate has a molecular weight of 427.80 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-5-naphthalen-2-yl-2-oxo-5H-pyrano[4,3-f][1,3]benzoxazol-1-yl) perchlorate is sourced from PubChem (CID 88880224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).