C11H19N3 — CID 88880587
2-[(2R,3E,5Z)-3-ethenyl-2-methylhepta-3,5-dienyl]guanidine (PubChem CID 88880587) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(2R,3E,5Z)-3-ethenyl-2-methylhepta-3,5-dienyl]guanidine.
| Compound Name | 2-[(2R,3E,5Z)-3-ethenyl-2-methylhepta-3,5-dienyl]guanidine |
|---|---|
| PubChem CID | 88880587 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-[(2R,3E,5Z)-3-ethenyl-2-methylhepta-3,5-dienyl]guanidine |
| SMILES | C=C/C(=C\C=C/C)[C@@H](C)CN=C(N)N |
| InChI | InChI=1S/C11H19N3/c1-4-6-7-10(5-2)9(3)8-14-11(12)13/h4-7,9H,2,8H2,1,3H3,(H4,12,13,14)/b6-4-,10-7+/t9-/m0/s1 |
| InChIKey | HHBSOGONEMMIPL-PWRSMJIISA-N |
| XLogP | 1.58 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|