C18H27FN4O5S — CID 88880731
S-[8-(hydroxyamino)-8-oxooctyl] N-[5-fluoro-1-[(2R,5R)-5-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamothioate (PubChem CID 88880731) has the molecular formula C18H27FN4O5S and a molecular weight of 430.50 g/mol. Its IUPAC name is S-[8-(hydroxyamino)-8-oxooctyl] N-[5-fluoro-1-[(2R,5R)-5-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamothioate.
| Compound Name | S-[8-(hydroxyamino)-8-oxooctyl] N-[5-fluoro-1-[(2R,5R)-5-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamothioate |
|---|---|
| PubChem CID | 88880731 |
| Molecular Formula | C18H27FN4O5S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | S-[8-(hydroxyamino)-8-oxooctyl] N-[5-fluoro-1-[(2R,5R)-5-methyloxolan-2-yl]-2-oxopyrimidin-4-yl]carbamothioate |
| SMILES | C[C@@H]1CC[C@H](n2cc(F)c(NC(=O)SCCCCCCCC(=O)NO)nc2=O)O1 |
| InChI | InChI=1S/C18H27FN4O5S/c1-12-8-9-15(28-12)23-11-13(19)16(20-17(23)25)21-18(26)29-10-6-4-2-3-5-7-14(24)22-27/h11-12,15,27H,2-10H2,1H3,(H,22,24)(H,20,21,25,26)/t12-,15-/m1/s1 |
| InChIKey | NCNBVSQHDGKKHH-IUODEOHRSA-N |
| XLogP | 3.19 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|