C15H13BrF3NO2 — CID 88880945
1-[(1R,9R,13S)-5-bromo-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone (PubChem CID 88880945) has the molecular formula C15H13BrF3NO2 and a molecular weight of 376.17 g/mol. Its IUPAC name is 1-[(1R,9R,13S)-5-bromo-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1R,9R,13S)-5-bromo-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 88880945 |
| Molecular Formula | C15H13BrF3NO2 |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 1-[(1R,9R,13S)-5-bromo-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@@]12CC3[C@H]1[C@@H](Cc1cc(Br)c(O)cc12)N3C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13BrF3NO2/c1-14-5-10-12(14)9(20(10)13(22)15(17,18)19)3-6-2-8(16)11(21)4-7(6)14/h2,4,9-10,12,21H,3,5H2,1H3/t9-,10?,12-,14+/m1/s1 |
| InChIKey | CPBDNUVXMYCMNX-IPDHXKBHSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |