About 4-ethyl-2,6-difluorobenzaldehyde
4-ethyl-2,6-difluorobenzaldehyde (PubChem CID 88881021) has the molecular formula C9H8F2O
and a molecular weight of 170.16 g/mol. Its IUPAC name is 4-ethyl-2,6-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-ethyl-2,6-difluorobenzaldehyde |
| PubChem CID | 88881021 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 4-ethyl-2,6-difluorobenzaldehyde |
| SMILES | CCc1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C9H8F2O/c1-2-6-3-8(10)7(5-12)9(11)4-6/h3-5H,2H2,1H3 |
| InChIKey | CFKFZXLACWSCPN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,6-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6-difluorobenzaldehyde?
The IUPAC name of 4-ethyl-2,6-difluorobenzaldehyde (CID 88881021) is 4-ethyl-2,6-difluorobenzaldehyde.
What is the SMILES notation for 4-ethyl-2,6-difluorobenzaldehyde?
The canonical SMILES for 4-ethyl-2,6-difluorobenzaldehyde is CCc1cc(F)c(C=O)c(F)c1.
What is the InChIKey of 4-ethyl-2,6-difluorobenzaldehyde?
The InChIKey is CFKFZXLACWSCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O/c1-2-6-3-8(10)7(5-12)9(11)4-6/h3-5H,2H2,1H3.
What are the key properties of 4-ethyl-2,6-difluorobenzaldehyde?
4-ethyl-2,6-difluorobenzaldehyde has a molecular weight of 170.16 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6-difluorobenzaldehyde is sourced from PubChem (CID 88881021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).