About 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid
3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 88881889) has the molecular formula C8H6F6O3S
and a molecular weight of 296.19 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid |
| PubChem CID | 88881889 |
| Molecular Formula | C8H6F6O3S |
| Molecular Weight | 296.19 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1=CC(C(F)(F)F)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C8H6F6O3S/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)18(15,16)17/h2-4H,1H2,(H,15,16,17) |
| InChIKey | TXLVRBRYYMFNEL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid?
The IUPAC name of 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid (CID 88881889) is 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid.
What is the SMILES notation for 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid?
The canonical SMILES for 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid is O=S(=O)(O)C1=CC(C(F)(F)F)CC(C(F)(F)F)=C1.
What is the InChIKey of 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid?
The InChIKey is TXLVRBRYYMFNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F6O3S/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)18(15,16)17/h2-4H,1H2,(H,15,16,17).
What are the key properties of 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid?
3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid has a molecular weight of 296.19 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-sulfonic acid is sourced from PubChem (CID 88881889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).