About [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate
[(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate (PubChem CID 88881986) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate.
Molecular Properties
| Compound Name | [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate |
| PubChem CID | 88881986 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate |
| SMILES | CCCCCCC(C)/C=C\COC(=O)OC(CC)C(C)C |
| InChI | InChI=1S/C18H34O3/c1-6-8-9-10-12-16(5)13-11-14-20-18(19)21-17(7-2)15(3)4/h11,13,15-17H,6-10,12,14H2,1-5H3/b13-11- |
| InChIKey | FSHSQOGWPNOPRC-QBFSEMIESA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate?
The IUPAC name of [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate (CID 88881986) is [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate.
What is the SMILES notation for [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate?
The canonical SMILES for [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate is CCCCCCC(C)/C=C\COC(=O)OC(CC)C(C)C.
What is the InChIKey of [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate?
The InChIKey is FSHSQOGWPNOPRC-QBFSEMIESA-N. The full InChI is InChI=1S/C18H34O3/c1-6-8-9-10-12-16(5)13-11-14-20-18(19)21-17(7-2)15(3)4/h11,13,15-17H,6-10,12,14H2,1-5H3/b13-11-.
What are the key properties of [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate?
[(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate has a molecular weight of 298.47 g/mol, XLogP of 5.74, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-methyldec-2-enyl] 2-methylpentan-3-yl carbonate is sourced from PubChem (CID 88881986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).