About 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole
5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole (PubChem CID 88882073) has the molecular formula C20H21NO5S
and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole.
Molecular Properties
| Compound Name | 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole |
| PubChem CID | 88882073 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole |
| SMILES | COOCc1c(OC)cc(-c2sncc2-c2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C20H21NO5S/c1-22-15-7-5-13(6-8-15)16-11-21-27-20(16)14-9-18(23-2)17(12-26-25-4)19(10-14)24-3/h5-11H,12H2,1-4H3 |
| InChIKey | HQADZBSHOKALSJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole?
The IUPAC name of 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole (CID 88882073) is 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole.
What is the SMILES notation for 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole?
The canonical SMILES for 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole is COOCc1c(OC)cc(-c2sncc2-c2ccc(OC)cc2)cc1OC.
What is the InChIKey of 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole?
The InChIKey is HQADZBSHOKALSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO5S/c1-22-15-7-5-13(6-8-15)16-11-21-27-20(16)14-9-18(23-2)17(12-26-25-4)19(10-14)24-3/h5-11H,12H2,1-4H3.
What are the key properties of 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole?
5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole has a molecular weight of 387.46 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-dimethoxy-4-(methylperoxymethyl)phenyl]-4-(4-methoxyphenyl)-1,2-thiazole is sourced from PubChem (CID 88882073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).